CAS 10463-37-3
:4-Hydroxy-3,5-dinitrophenylacetic acid
Description:
4-Hydroxy-3,5-dinitrophenylacetic acid, with the CAS number 10463-37-3, is an organic compound characterized by its aromatic structure featuring a phenolic hydroxyl group and two nitro substituents on the benzene ring. This compound is a derivative of acetic acid, which contributes to its acidic properties. The presence of the hydroxyl group enhances its solubility in polar solvents, while the nitro groups are known to impart significant electron-withdrawing characteristics, affecting the compound's reactivity and stability. Typically, it appears as a yellow crystalline solid and is used in various chemical applications, including as an intermediate in organic synthesis and in the development of dyes and pharmaceuticals. Its chemical behavior is influenced by the functional groups present, making it a subject of interest in studies related to reactivity and interaction with biological systems. Safety precautions should be observed when handling this compound due to its potential toxicity and environmental impact.
Formula:C8H6N2O7
InChI:InChI=1/C8H6N2O7/c11-7(12)3-4-1-5(9(14)15)8(13)6(2-4)10(16)17/h1-2,13H,3H2,(H,11,12)
Synonyms:- 3,5-Dinitro-4-hydroxyphenylacetic acid
- 4-Hydroxy-3,5-dinitrobenzeneacetic acid
- 3,5-dinitro-4-hydroxyphenacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,5-Dinitro-4-hydroxyphenylacetic acid
CAS:Formula:C8H6N2O7Purity:98%Color and Shape:SolidMolecular weight:242.14243,5-Dinitro-4-hydroxyphenylacetic acid
CAS:3,5-Dinitro-4-hydroxyphenylacetic acidPurity:98%Molecular weight:242.14244g/mol3,5-Dinitro-4-hydroxyphenylacetic acid
CAS:<p>3,5-Dinitro-4-hydroxyphenylacetic acid is a conjugate that consists of an antigen and a carrier molecule. It is used to enhance the immune response by stimulating T cells which are responsible for the production of antibodies. The conjugate is also known to have cytotoxic effects on the surface of cancer cells in vitro. 3,5-Dinitro-4-hydroxyphenylacetic acid has been shown to be effective in immunizing mice against the antigen ovalbumin, which is often used as a model antigen in immunology research. This conjugate has been shown to promote mitogenesis, or cell division, in spleen cells isolated from immunized mice.</p>Formula:C8H6N2O7Purity:Min. 95%Molecular weight:242.14 g/mol3,5-Dinitro-4-hydroxyphenylacetic acid
CAS:Formula:C8H6N2O7Purity:98%Color and Shape:SolidMolecular weight:242.143




