CAS 104632-27-1: 2,6-Benzothiazolediamine, 4,5,6,7-tetrahydro-N<sup>6</sup>-propyl-, hydrochloride (1:2), (6R)-
Description:2,6-Benzothiazolediamine, 4,5,6,7-tetrahydro-N^6-propyl-, hydrochloride (1:2), (6R)-, identified by CAS number 104632-27-1, is a chemical compound characterized by its unique bicyclic structure that incorporates both benzothiazole and diamine functionalities. This compound typically appears as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications, particularly in pharmaceutical and biochemical contexts. The presence of the tetrahydro group contributes to its potential biological activity, while the propyl substituent may influence its lipophilicity and interaction with biological targets. The stereochemistry indicated by (6R) suggests specific spatial arrangements that can affect the compound's reactivity and interactions. Overall, this substance may exhibit properties relevant to medicinal chemistry, including potential use as a therapeutic agent or in research applications, although specific biological activities and mechanisms would require further investigation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C10H17N3S·2ClH
InChI:InChI=1S/C10H17N3S.2ClH/c1-2-5-12-7-3-4-8-9(6-7)14-10(11)13-8;;/h7,12H,2-6H2,1H3,(H2,11,13);2*1H/t7-;;/m1../s1
InChI key:InChIKey=QMNWXHSYPXQFSK-XCUBXKJBSA-N
SMILES:Cl.N1=C(SC2=C1CCC(NCCC)C2)N
- Synonyms:
- (R)-4,5,6,7-Tetrahydro-6-(propylamino)-benzothiazole-2-amine dihydrochloride
- SND 919CL2X
- 2,6-Benzothiazolediamine, 4,5,6,7-tetrahydro-N6-propyl-, dihydrochloride, (6R)-
- 2,6-Benzothiazolediamine, 4,5,6,7-tetrahydro-N6-propyl-, dihydrochloride, (R)-
- 2,6-Benzothiazolediamine, 4,5,6,7-tetrahydro-N6-propyl-, hydrochloride (1:2), (6R)-