CAS 10464-31-0
:5-Benzyl-10-oxo-10,11-dihydro-5H-dibenz[b,f]azepine
Description:
5-Benzyl-10-oxo-10,11-dihydro-5H-dibenz[b,f]azepine is a chemical compound characterized by its complex bicyclic structure, which includes a dibenzazepine framework. This compound features a benzyl group and a ketone functional group, contributing to its unique reactivity and potential biological activity. The presence of the oxo group indicates that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the dibenzazepine core, which is often associated with psychoactive and therapeutic properties. The compound's molecular weight, solubility, and stability can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, to mitigate any potential hazards associated with its use. Overall, 5-Benzyl-10-oxo-10,11-dihydro-5H-dibenz[b,f]azepine represents a significant area of interest for further research and application in various chemical and pharmaceutical fields.
Formula:C21H17NO
InChI:InChI=1/C21H17NO/c23-21-14-17-10-4-6-12-19(17)22(15-16-8-2-1-3-9-16)20-13-7-5-11-18(20)21/h1-13H,14-15H2
SMILES:c1ccc(cc1)CN1c2ccccc2CC(=O)c2ccccc12
Synonyms:- 5-Benzyl-10,11-dihydro-5H-dibenz[b,f]azepin-10-one
- 5,10-Dihydro-5-(phenylmethyl)-10H-dibenz[b,f]azepin-10-one,
- 5-benzyl-5,11-dihydro-10H-dibenzo[b,f]azepin-10-one
- 5-Benzyl-10-oxo-10,11-dihydro-5H-dibenz[b,f]azepine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.