CAS 1046463-05-1
:3-Tricyclo[3.3.1.13,7]dec-1-yl-5-(trifluoromethyl)-1H-pyrazole
Description:
3-Tricyclo[3.3.1.1^3,7]dec-1-yl-5-(trifluoromethyl)-1H-pyrazole is a complex organic compound characterized by its unique bicyclic structure and the presence of a trifluoromethyl group. The tricyclic framework contributes to its rigidity and potential for interesting chemical reactivity. The trifluoromethyl group is known for imparting significant lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry. The pyrazole moiety is a five-membered ring containing two nitrogen atoms, which can participate in various chemical reactions and may exhibit diverse pharmacological properties. This compound may also exhibit specific solubility characteristics depending on the solvent, and its stability can be influenced by environmental factors such as temperature and pH. Overall, the structural features of this compound suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation through experimental studies.
Formula:C14H17F3N2
InChI:InChI=1S/C14H17F3N2/c15-14(16,17)12-4-11(18-19-12)13-5-8-1-9(6-13)3-10(2-8)7-13/h4,8-10H,1-3,5-7H2,(H,18,19)
InChI key:InChIKey=HRJUBPDQLPHDKZ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(C23CC4CC(C2)CC(C3)C4)=NN1
Synonyms:- 3-Tricyclo[3.3.1.13,7]dec-1-yl-5-(trifluoromethyl)-1H-pyrazole
- 1H-Pyrazole, 3-tricyclo[3.3.1.13,7]dec-1-yl-5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.