
CAS 1046469-20-8
:Phenylmethyl N-(2-methoxycyclopropyl)carbamate
Description:
Phenylmethyl N-(2-methoxycyclopropyl)carbamate, identified by its CAS number 1046469-20-8, is a chemical compound that belongs to the class of carbamates. This substance features a phenylmethyl group, which contributes to its aromatic characteristics, and a methoxycyclopropyl moiety that introduces a unique cyclic structure into its framework. The presence of the carbamate functional group indicates that it may exhibit properties typical of such compounds, including potential biological activity and applications in medicinal chemistry. The methoxy group can enhance solubility and influence the compound's reactivity. Additionally, the cyclopropyl ring may impart strain, which can affect the stability and reactivity of the molecule. Overall, the structural features of Phenylmethyl N-(2-methoxycyclopropyl)carbamate suggest it may have interesting pharmacological properties, although specific biological activities would require further investigation through experimental studies. As with many carbamate derivatives, it is essential to consider safety and handling protocols due to potential toxicity and environmental impact.
Formula:C12H15NO3
InChI:InChI=1S/C12H15NO3/c1-15-11-7-10(11)13-12(14)16-8-9-5-3-2-4-6-9/h2-6,10-11H,7-8H2,1H3,(H,13,14)
InChI key:InChIKey=WGLIJHANEQMZMY-UHFFFAOYSA-N
SMILES:N(C(OCC1=CC=CC=C1)=O)C2C(OC)C2
Synonyms:- Phenylmethyl N-(2-methoxycyclopropyl)carbamate
- Carbamic acid, N-(2-methoxycyclopropyl)-, phenylmethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.