CAS 104653-89-6
:Fusarochromanone
Description:
Fusarochromanone is a chemical compound classified as a natural product and is known for its occurrence in certain fungi, particularly those belonging to the Fusarium genus. It is characterized by its unique chromone structure, which contributes to its biological activity. The compound exhibits various properties, including potential antifungal and antibacterial activities, making it of interest in pharmaceutical research. Fusarochromanone has been studied for its role in plant-pathogen interactions and may have implications in agricultural applications. Its molecular structure includes a chromone ring fused with a carbonyl group, which is typical of many bioactive natural products. The compound's solubility and stability can vary depending on environmental conditions, influencing its bioavailability and efficacy. As research continues, the exploration of fusarochromanone's mechanisms of action and potential therapeutic applications remains a significant area of interest in both chemistry and biology.
Formula:C15H20N2O4
InChI:InChI=1S/C15H20N2O4/c1-15(2)6-11(20)13-12(21-15)4-3-9(14(13)17)10(19)5-8(16)7-18/h3-4,8,18H,5-7,16-17H2,1-2H3
InChI key:InChIKey=COSICWYFCAPPJB-UHFFFAOYSA-N
SMILES:NC1=C2C(=CC=C1C(CC(CO)N)=O)OC(C)(C)CC2=O
Synonyms:- 4H-1-Benzopyran-4-one, 5-amino-6-(3-amino-4-hydroxy-1-oxobutyl)-2,3-dihydro-2,2-dimethyl-
- 5-Amino-6-(3-amino-4-hydroxy-1-oxobutyl)-2,3-dihydro-2,2-dimethyl-4H-1-benzopyran-4-one
- 5-amino-6-(3-amino-4-hydroxybutanoyl)-2,2-dimethyl-2,3-dihydro-4H-chromen-4-one
- Fusarochromenone
- Tdp-1
- TDP 1 (mycotoxin)
- Fusarochromanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
