CAS 10466-56-5
:L-isoleucinamide hydrochloride
Description:
L-Isoleucinamide hydrochloride is a chemical compound that serves as a derivative of the amino acid isoleucine. It is characterized by its amide functional group, which contributes to its solubility and reactivity. This compound typically appears as a white to off-white crystalline powder and is hygroscopic, meaning it can absorb moisture from the environment. L-Isoleucinamide hydrochloride is often utilized in biochemical research and pharmaceutical applications, particularly in the synthesis of peptides and as a building block in drug development. Its hydrochloride form enhances its stability and solubility in aqueous solutions, making it suitable for various laboratory procedures. The compound is generally considered to be non-toxic, but like many chemical substances, it should be handled with care in a controlled environment to avoid any potential hazards. Overall, L-isoleucinamide hydrochloride is an important compound in the field of organic chemistry and biochemistry, contributing to advancements in medicinal chemistry and related disciplines.
Formula:C6H15ClN2O
InChI:InChI=1/C6H14N2O.ClH/c1-3-4(2)5(7)6(8)9;/h4-5H,3,7H2,1-2H3,(H2,8,9);1H/t4-,5-;/m0./s1
SMILES:CC[C@H](C)[C@@H](C(=N)O)N.Cl
Synonyms:- H-Ile-NH2.HCl
- H-Ile-NH2・HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
L-Isoleucinamide Hydrochloride
CAS:Formula:C6H14N2O·HClPurity:>98.0%(N)Color and Shape:White to Almost white powder to crystalMolecular weight:166.65L-Isoleucinamide Hydrochloride
CAS:L-Isoleucinamide HydrochloridePurity:98%Molecular weight:166.65g/molL-Isoleucine amide hydrochloride
CAS:L-Isoleucine amide hydrochloride is a high quality reagent that is useful as an intermediate, fine chemical or speciality chemical. It can be used to synthesize compounds with a wide range of properties and uses. L-Isoleucine amide hydrochloride can be used in research for the development of new drugs or other chemicals. The versatility of this reagent makes it a useful building block for reactions involving amino acids, peptides, nucleosides, and carbohydrates.Formula:C6H14N2O·HClPurity:Min. 95%Color and Shape:White PowderMolecular weight:166.65 g/mol




