CAS 10466-72-5: Dinitrophenyl-ε-aminocaproic acid
Description:Dinitrophenyl-ε-aminocaproic acid, with the CAS number 10466-72-5, is a chemical compound characterized by its structure, which includes a dinitrophenyl group attached to an ε-aminocaproic acid moiety. This compound typically exhibits properties associated with both aromatic and aliphatic functionalities, making it a versatile molecule in various chemical applications. The presence of the dinitrophenyl group imparts significant reactivity, particularly in electrophilic substitution reactions, while the ε-aminocaproic acid component contributes to its solubility in polar solvents and potential biological activity. Dinitrophenyl derivatives are often utilized in biochemical assays and as intermediates in organic synthesis. Additionally, the compound may exhibit specific interactions with biological macromolecules, which can be of interest in pharmacological studies. Safety considerations are important, as dinitrophenyl compounds can be hazardous, necessitating careful handling and appropriate safety measures in laboratory settings. Overall, Dinitrophenyl-ε-aminocaproic acid serves as a valuable compound in both research and industrial applications.
Formula:C12H15N3O6
InChI:InChI=1S/C12H15N3O6/c16-12(17)4-2-1-3-7-13-10-6-5-9(14(18)19)8-11(10)15(20)21/h5-6,8,13H,1-4,7H2,(H,16,17)
InChI key:InChIKey=ZYUWUKIAUDIXCQ-UHFFFAOYSA-N
SMILES:O=C(O)CCCCCNC1=CC=C(C=C1N(=O)=O)N(=O)=O
- Synonyms:
- 6-(2,4-Dinitroanilino)caproic acid
- 6-[(2,4-Dinitrophenyl)Amino]Hexanoic Acid
- DNP-?-Aminocaproic acid 2,4-Dinitrophenyl-?-aminocaproic acid
- DNP-ε-amino-n-caproic acid
- Dinitrophenyl-ε-aminocaproic acid
- Hexanoic acid, 6-(2,4-dinitroanilino)-
- Hexanoic acid, 6-[(2,4-dinitrophenyl)amino]-
- N-(2,4-Dinitrophenyl)-6-aminocaproic acid
- N-(2,4-Dinitrophenyl)-6-aminohexanoic acid
- N-(2,4-Dinitrophenyl)-ε-aminocaproic acid
- See more synonyms
- NSC 89627
- [(2,4-Dinitrophenyl)amino]caproic acid
- ε-2,4-Dinitrophenylaminocaproic acid