CAS 104668-88-4

4H-1-Benzopyran-4-one,5-hydroxy-3-(4-hydroxy-3-methoxyphenyl)-7-methoxy-

Description:

The chemical substance known as 4H-1-Benzopyran-4-one, 5-hydroxy-3-(4-hydroxy-3-methoxyphenyl)-7-methoxy- is a flavonoid compound, characterized by its complex polyphenolic structure. It features a benzopyran core, which is typical of many flavonoids, and includes multiple hydroxyl and methoxy groups that contribute to its chemical reactivity and potential biological activity. The presence of these functional groups often enhances the compound's antioxidant properties, making it of interest in various fields, including pharmacology and nutrition. This compound may exhibit various biological activities, such as anti-inflammatory, antimicrobial, or anticancer effects, although specific activities can vary based on structural modifications and environmental conditions. Its solubility and stability can be influenced by the presence of the methoxy and hydroxyl groups, which also play a role in its interaction with biological systems. Overall, this compound represents a class of natural products that are significant in both medicinal chemistry and natural product research.

Formula: C₁₇H₁₄O₆

InChI: InChI=1S/C17H14O6/c1-21-10-6-13(19)16-15(7-10)23-8-11(17(16)20)9-3-4-12(18)14(5-9)22-2/h3-8,18-19H,1-2H3

InChI key: InChIKey=NMQZMHHAWZDJOJ-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC(OC)=CC2O)OC=C1C3=CC(OC)=C(O)C=C3

7,3'-Di-O-methylorobol

CAS: 104668-88-4

Formula: C₁₇H₁₄O₆

Purity: 98.5%

Color and Shape: Solid

Molecular weight: 314.2895

Ref: IN-DA0092XA

7,3'-Di-O-Methylorobol

CAS: 104668-88-4

7,3'-Di-O-Methylorobol is a naturally occurring flavonoid found in Sophora japonica that is used in biochemical experiments and organic synthesis.

Formula: C₁₇H₁₄O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 314.29

Ref: TM-TN3210

7,3'-Di-O-methylorobol

CAS: 104668-88-4

Formula: C₁₇H₁₄O₆

Purity: 95%~99%

Molecular weight: 314.293

Ref: BP-SBP03793

Orobol 7,3'-dimethyl ether

CAS: 104668-88-4

Orobol 7,3'-dimethyl ether is a flavonoid compound, which is derived from natural plant sources. This compound is synthesized as a methylated ether of Orobol, a type of isoflavone. The mode of action of Orobol 7,3'-dimethyl ether involves interacting with biological pathways that may influence cellular processes, including antioxidant and anti-inflammatory activities. By modulating these pathways, it potentially impacts various physiological functions.

Formula: C₁₇H₁₄O₆

Purity: Min. 95%

Molecular weight: 314.29 g/mol

Ref: 3D-FO65376