CAS 104669-02-5: (1S)-1,5-anhydro-1-[2,4,6-trihydroxy-3-(4-hydroxybenzoyl)phenyl]-D-glucitol
Description:(1S)-1,5-Anhydro-1-[2,4,6-trihydroxy-3-(4-hydroxybenzoyl)phenyl]-D-glucitol, with CAS number 104669-02-5, is a complex organic compound characterized by its structural features that include a glucitol backbone and multiple hydroxyl groups. This compound exhibits significant solubility in polar solvents due to its numerous hydroxyl groups, which can engage in hydrogen bonding. The presence of the phenolic moiety, specifically the 4-hydroxybenzoyl group, contributes to its potential antioxidant properties, making it of interest in various biochemical applications. Its stereochemistry, indicated by the (1S) configuration, suggests specific spatial arrangements that may influence its biological activity and interaction with other molecules. Additionally, the compound's anhydro form indicates the absence of water in its structure, which can affect its stability and reactivity. Overall, this substance may have applications in pharmaceuticals, food science, or as a biochemical probe, although specific uses would depend on further research into its properties and interactions.
Formula:C19H20O10
InChI:InChI=1/C19H20O10/c20-6-11-15(25)17(27)18(28)19(29-11)13-10(23)5-9(22)12(16(13)26)14(24)7-1-3-8(21)4-2-7/h1-5,11,15,17-23,25-28H,6H2/t11-,15-,17+,18-,19+/m1/s1