CymitQuimica logo

CAS 104669-73-0

:

N2-[(1,1-Dimethylethoxy)carbonyl]-N6-[(2-propen-1-yloxy)carbonyl]-L-lysine

Description:
N2-[(1,1-Dimethylethoxy)carbonyl]-N6-[(2-propen-1-yloxy)carbonyl]-L-lysine, with CAS number 104669-73-0, is a synthetic amino acid derivative that features modifications on the lysine side chain. This compound is characterized by the presence of two distinct protective groups: a dimethylethoxycarbonyl group at the N2 position and a propenyloxycarbonyl group at the N6 position. These modifications enhance the compound's stability and reactivity, making it useful in various biochemical applications, including peptide synthesis and drug development. The presence of the propenyloxy group suggests potential for further chemical transformations, such as polymerization or conjugation reactions. Additionally, the compound's structure allows for solubility in organic solvents, which is advantageous for laboratory handling. Overall, this compound exemplifies the versatility of amino acid derivatives in medicinal chemistry and bioconjugation strategies, facilitating the design of novel therapeutic agents.
Formula:C15H26N2O6
InChI:InChI=1S/C15H26N2O6/c1-5-10-22-13(20)16-9-7-6-8-11(12(18)19)17-14(21)23-15(2,3)4/h5,11H,1,6-10H2,2-4H3,(H,16,20)(H,17,21)(H,18,19)/t11-/m0/s1
InChI key:InChIKey=WSUYYYMWIGBPJO-NSHDSACASA-N
SMILES:[C@H](NC(OC(C)(C)C)=O)(CCCCNC(OCC=C)=O)C(O)=O
Synonyms:
  • N2-[(1,1-Dimethylethoxy)carbonyl]-N6-[(2-propen-1-yloxy)carbonyl]-L-lysine
  • L-Lysine, N2-[(1,1-dimethylethoxy)carbonyl]-N6-[(2-propen-1-yloxy)carbonyl]-
  • L-Lysine, N2-[(1,1-dimethylethoxy)carbonyl]-N6-[(2-propenyloxy)carbonyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.