CAS 1046757-31-6

Acetamide, 2-amino-N-(5-fluoro-2-methylphenyl)-, hydrochloride (1:1)

Description:

Acetamide, 2-amino-N-(5-fluoro-2-methylphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This substance features a 5-fluoro-2-methylphenyl moiety, indicating the presence of a fluorine atom and a methyl group on a phenyl ring, contributing to its unique properties. The hydrochloride form suggests that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the amino group indicates potential basicity and reactivity, which can be exploited in synthetic pathways or biological interactions. This compound may exhibit specific biological activities, making it of interest in medicinal chemistry. Its molecular structure and properties can influence its behavior in biological systems, including pharmacokinetics and pharmacodynamics. As with many chemical substances, safety data and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₉H₁₁FN₂O·ClH

InChI: InChI=1S/C9H11FN2O.ClH/c1-6-2-3-7(10)4-8(6)12-9(13)5-11;/h2-4H,5,11H2,1H3,(H,12,13);1H

InChI key: InChIKey=CEXJYIFYRGISQX-UHFFFAOYSA-N

SMILES: N(C(CN)=O)C1=C(C)C=CC(F)=C1.Cl

Synonyms:

• Acetamide, 2-amino-N-(5-fluoro-2-methylphenyl)-, hydrochloride (1:1)

N~1~-(5-fluoro-2-methylphenyl)glycinamide hydrochloride

CAS: 1046757-31-6

Formula: C₉H₁₂ClFN₂O

Purity: 95.0%

Molecular weight: 218.66

Ref: 10-F360039