CAS 1046757-37-2

Acetamide, 2-amino-N-(2,5-difluorophenyl)-, hydrochloride (1:1)

Description:

Acetamide, 2-amino-N-(2,5-difluorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This substance features a 2-amino group, indicating the presence of an amino functional group attached to the carbon chain, which enhances its solubility in polar solvents. The difluorophenyl moiety suggests that the compound has two fluorine atoms substituted on a phenyl ring, which can significantly influence its electronic properties and reactivity. As a hydrochloride salt, it exists in a stable ionic form, which typically enhances its solubility in water and may affect its pharmacological properties. The presence of fluorine atoms often contributes to increased lipophilicity and can modulate biological activity. This compound may be of interest in medicinal chemistry and drug development due to its potential biological activities, although specific applications would depend on further research and characterization. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₈H₈F₂N₂O·ClH

InChI: InChI=1S/C8H8F2N2O.ClH/c9-5-1-2-6(10)7(3-5)12-8(13)4-11;/h1-3H,4,11H2,(H,12,13);1H

InChI key: InChIKey=MFICBTPGWRETDY-UHFFFAOYSA-N

SMILES: N(C(CN)=O)C1=C(F)C=CC(F)=C1.Cl

Synonyms:

• Acetamide, 2-amino-N-(2,5-difluorophenyl)-, hydrochloride (1:1)

N~1~-(2,5-difluorophenyl)glycinamide hydrochloride

CAS: 1046757-37-2

Formula: C₈H₉ClF₂N₂O

Purity: 95.0%

Molecular weight: 222.62

Ref: 10-F360066