CAS 1046757-40-7

Propanamide, 3-amino-N-2-thiazolyl-, hydrochloride (1:1)

Description:

Propanamide, 3-amino-N-2-thiazolyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and the presence of a thiazole ring, which contributes to its biological activity. The hydrochloride form indicates that it is a salt, enhancing its solubility in water, which is beneficial for pharmaceutical applications. This compound typically exhibits properties such as moderate polarity due to the amide and thiazole functionalities, which can influence its interaction with biological targets. It may also possess potential pharmacological activities, making it of interest in medicinal chemistry. The presence of the amino group suggests that it can participate in hydrogen bonding, affecting its reactivity and stability. Additionally, the thiazole moiety is known for its role in various biological processes, potentially contributing to the compound's efficacy in therapeutic contexts. Overall, this compound's unique structural features and properties make it a candidate for further research in drug development and related fields.

Formula: C₆H₉N₃OS·ClH

InChI: InChI=1S/C6H9N3OS.ClH/c7-2-1-5(10)9-6-8-3-4-11-6;/h3-4H,1-2,7H2,(H,8,9,10);1H

InChI key: InChIKey=XOGGRINWSOXAKZ-UHFFFAOYSA-N

SMILES: N(C(CCN)=O)C1=NC=CS1.Cl

Synonyms:

• Propanamide, 3-amino-N-2-thiazolyl-, hydrochloride (1:1)