CAS 104678-14-0

2-[(Phenylmethoxy)methyl]piperidine

Description:

2-[(Phenylmethoxy)methyl]piperidine, with the CAS number 104678-14-0, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a phenylmethoxy group, indicating the presence of a phenyl ring attached to a methoxy group, which is further linked to the piperidine structure. The presence of the methoxy group suggests that it may exhibit ether-like properties, while the phenyl group can contribute to its hydrophobic characteristics. The compound is likely to be a solid at room temperature, with potential applications in medicinal chemistry due to its structural features that may influence biological activity. Its molecular structure suggests it could interact with various biological targets, making it of interest in drug development. Additionally, the presence of the piperidine ring may impart basic properties, allowing for protonation under certain conditions. As with many organic compounds, its solubility, stability, and reactivity would depend on the specific conditions and solvents used.

Formula: C₁₃H₁₉NO

InChI: InChI=1S/C13H19NO/c1-2-6-12(7-3-1)10-15-11-13-8-4-5-9-14-13/h1-3,6-7,13-14H,4-5,8-11H2

InChI key: InChIKey=QJQFTDCEQKMEFU-UHFFFAOYSA-N

SMILES: C(OCC1CCCCN1)C2=CC=CC=C2

Synonyms:

• 2-[(Benzyloxy)methyl]piperidine
• 2-[(Phenylmethoxy)methyl]piperidine
• 2-(Benzyloxymethyl)piperidine
• Piperidine, 2-[(phenylmethoxy)methyl]-