CymitQuimica logo

CAS 104678-86-6

:

4-CHLORO-1-TRIFLUOROMETHOXY-2-TRIFLUOROMETHYL-BENZENE

Description:
4-Chloro-1-trifluoromethoxy-2-trifluoromethyl-benzene, with the CAS number 104678-86-6, is an aromatic compound characterized by the presence of multiple halogen substituents. This compound features a benzene ring substituted with a chloro group and two trifluoromethyl groups, as well as a trifluoromethoxy group. The presence of these electronegative fluorine and chlorine atoms significantly influences its chemical properties, including increased lipophilicity and potential reactivity in electrophilic aromatic substitution reactions. The trifluoromethoxy group enhances the compound's stability and can affect its solubility in various solvents. Additionally, the compound may exhibit unique biological activities due to its halogenated structure, making it of interest in pharmaceutical and agrochemical research. Its physical properties, such as boiling point and melting point, are influenced by the steric and electronic effects of the substituents. Overall, this compound is notable for its complex structure and potential applications in various chemical fields.
Formula:C8H3ClF6O
InChI:InChI=1/C8H3ClF6O/c9-4-1-2-6(16-8(13,14)15)5(3-4)7(10,11)12/h1-3H
SMILES:c1cc(c(cc1Cl)C(F)(F)F)OC(F)(F)F
Synonyms:
  • 5-Chloro-2-(Trifluoromethoxy)Benzotrifluoride
  • 5-Chloro-2-(Trifluormethoxy)-Benzotrifluoride
  • 5-Chloro-2-(Trifluoromethoxy)Benzotrifluoroide
  • N6-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine
  • 4-CHLORO-1-TRIFLUOROMETHOXY-2-TRIFLUOROMETHYL-BENZENE
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.