CymitQuimica logo

CAS 1046788-78-6

:

(2R,5S)-1,2,5-trimethylpiperazine

Description:
(2R,5S)-1,2,5-trimethylpiperazine is a cyclic organic compound characterized by a piperazine ring with three methyl substituents. The piperazine structure consists of a six-membered ring containing two nitrogen atoms at opposite positions, which contributes to its basicity and potential for forming hydrogen bonds. The specific stereochemistry indicated by the (2R,5S) configuration suggests that the compound has distinct spatial arrangements, influencing its reactivity and interactions with biological systems. This compound is typically colorless to pale yellow and may exhibit a characteristic amine-like odor. Its solubility in polar solvents, such as water and alcohols, is notable due to the presence of nitrogen atoms, which can engage in hydrogen bonding. (2R,5S)-1,2,5-trimethylpiperazine may find applications in organic synthesis, pharmaceuticals, or as a building block in the development of more complex molecules. However, its specific applications and biological activity would depend on further research and characterization. Safety data should be consulted before handling, as with any chemical substance.
Formula:C7H16N2
InChI:InChI=1/C7H16N2/c1-6-5-9(3)7(2)4-8-6/h6-8H,4-5H2,1-3H3/t6-,7+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.