CymitQuimica logo

CAS 1046793-61-6

:

4-(4-Methyl-1-piperazinyl)-1-cyclohexen-1-yl 1,1,1-trifluoromethanesulfonate

Description:
4-(4-Methyl-1-piperazinyl)-1-cyclohexen-1-yl 1,1,1-trifluoromethanesulfonate, with CAS number 1046793-61-6, is a chemical compound characterized by its unique structure that includes a cyclohexene ring and a piperazine moiety. The presence of the trifluoromethanesulfonate group indicates that it is a sulfonate ester, which typically enhances its reactivity, particularly in nucleophilic substitution reactions. This compound is likely to exhibit properties such as moderate solubility in polar organic solvents due to the polar sulfonate group, while the cyclohexene and piperazine components may contribute to its hydrophobic characteristics. Additionally, the trifluoromethyl group can impart unique electronic properties, potentially influencing its reactivity and interaction with biological systems. The compound may be of interest in medicinal chemistry or materials science, given the functional groups present, which could facilitate various chemical transformations or biological activities. However, specific safety and handling information should be consulted, as with any chemical substance.
Formula:C12H19F3N2O3S
InChI:InChI=1S/C12H19F3N2O3S/c1-16-6-8-17(9-7-16)10-2-4-11(5-3-10)20-21(18,19)12(13,14)15/h4,10H,2-3,5-9H2,1H3
InChI key:InChIKey=RSXLXEWWJGZMLC-UHFFFAOYSA-N
SMILES:O(S(C(F)(F)F)(=O)=O)C=1CCC(CC1)N2CCN(C)CC2
Synonyms:
  • 4-(4-Methyl-1-piperazinyl)-1-cyclohexen-1-yl 1,1,1-trifluoromethanesulfonate
  • Methanesulfonic acid, 1,1,1-trifluoro-, 4-(4-methyl-1-piperazinyl)-1-cyclohexen-1-yl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.