CAS 10468-16-3

2-chlorophenylhydroxylamine

Description:

2-Chlorophenylhydroxylamine, with the CAS number 10468-16-3, is an organic compound characterized by the presence of a hydroxylamine functional group attached to a chlorinated phenyl ring. This compound typically appears as a solid or crystalline substance and is known for its potential applications in organic synthesis and as a reagent in various chemical reactions. The chlorophenyl moiety contributes to its reactivity and solubility properties, influencing its behavior in different solvents. Hydroxylamines are generally recognized for their ability to act as reducing agents and nucleophiles, making them valuable in the synthesis of amines and other nitrogen-containing compounds. Additionally, 2-chlorophenylhydroxylamine may exhibit biological activity, which can be of interest in medicinal chemistry. However, handling this compound requires caution due to its potential toxicity and the need for appropriate safety measures in laboratory settings. Overall, 2-chlorophenylhydroxylamine is a versatile compound with significant implications in both synthetic and applied chemistry.

Formula: C₆H₆ClNO

InChI: InChI=1/C6H6ClNO/c7-5-3-1-2-4-6(5)8-9/h1-4,8-9H

SMILES: c1ccc(c(c1)Cl)NO

Synonyms:

• 2-Chloro-N-hydroxybenzenamine
• Benzenamine, 2-chloro-N-hydroxy-
• 2-chloro-N-hydroxyaniline
• 2-Chlorophenylhydroxylamine