CymitQuimica logo

CAS 1046812-00-3

:

3,4-Dihydro-4,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyran

Description:
3,4-Dihydro-4,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyran is a complex organic compound characterized by its unique structural features, including a pyran ring and a dioxaborolane moiety. The presence of the dioxaborolane group suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions and as a reagent in organic synthesis. The compound's structure indicates it may exhibit interesting reactivity due to the boron atom, which can participate in various chemical transformations. Additionally, the presence of multiple methyl groups contributes to its steric bulk, potentially influencing its solubility and reactivity. The compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its synthesis may involve multi-step organic reactions, and it could be of interest in medicinal chemistry or materials science due to its unique properties. As with many organoboron compounds, it may also exhibit specific interactions with biological systems, warranting further investigation into its potential applications.
Formula:C13H23BO3
InChI:InChI=1S/C13H23BO3/c1-11(2)7-8-15-10(9-11)14-16-12(3,4)13(5,6)17-14/h9H,7-8H2,1-6H3
InChI key:InChIKey=AEQRSWQINRYVLU-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(C)(C)CCO2
Synonyms:
  • 3,4-Dihydro-4,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyran
  • 2-(4,4-Dimethyl-2,3-dihydropyran-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
  • 2-(4,4-Dimethyl-3,4-dihydro-2H-pyran-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
  • 2H-Pyran, 3,4-dihydro-4,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.