
CAS 1046815-84-2
:1,2,3,4-Tetrahydro-2-(methylsulfonyl)-6-isoquinolinamine
Description:
1,2,3,4-Tetrahydro-2-(methylsulfonyl)-6-isoquinolinamine is a chemical compound characterized by its isoquinoline structure, which is a bicyclic compound featuring a fused benzene and pyridine ring. This substance contains a tetrahydroisoquinoline moiety, indicating that it has undergone partial hydrogenation, resulting in a saturated ring system. The presence of a methylsulfonyl group contributes to its polar characteristics, enhancing its solubility in polar solvents. The amine functional group suggests potential basicity and reactivity, particularly in forming salts or participating in nucleophilic reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific properties, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods. Overall, the unique combination of functional groups and structural features in 1,2,3,4-Tetrahydro-2-(methylsulfonyl)-6-isoquinolinamine suggests potential applications in various chemical and biological contexts.
Formula:C10H14N2O2S
InChI:InChI=1S/C10H14N2O2S/c1-15(13,14)12-5-4-8-6-10(11)3-2-9(8)7-12/h2-3,6H,4-5,7,11H2,1H3
InChI key:InChIKey=SGYAQZDDLVUVOG-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)N1CC=2C(CC1)=CC(N)=CC2
Synonyms:- 6-Isoquinolinamine, 1,2,3,4-tetrahydro-2-(methylsulfonyl)-
- 2-Methanesulfonyl-1,2,3,4-tetrahydro-isoquinolin-6-ylamine
- 1,2,3,4-Tetrahydro-2-(methylsulfonyl)-6-isoquinolinamine
- 2-(Methylsulfonyl)-6-amino-1,2,3,4-tetrahydroisoquinoline
- 2-Methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-amine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery