CymitQuimica logo

CAS 1046832-00-1

:

4,4,5,5-Tetramethyl-2-(3-methyl-1-cyclohexen-1-yl)-1,3,2-dioxaborolane

Description:
4,4,5,5-Tetramethyl-2-(3-methyl-1-cyclohexen-1-yl)-1,3,2-dioxaborolane is an organoboron compound characterized by its unique dioxaborolane structure, which features a boron atom bonded to two oxygen atoms and a carbon framework. This compound contains a cyclohexene moiety, contributing to its potential reactivity and applications in organic synthesis. The presence of multiple methyl groups enhances its steric bulk, influencing its chemical behavior and solubility. Typically, compounds like this are utilized in various synthetic pathways, particularly in the formation of carbon-carbon bonds, making them valuable in the development of pharmaceuticals and agrochemicals. The dioxaborolane structure is known for its ability to participate in cross-coupling reactions, which are essential in modern organic chemistry. Additionally, the compound's stability and reactivity can be affected by environmental factors such as temperature and moisture. Overall, 4,4,5,5-Tetramethyl-2-(3-methyl-1-cyclohexen-1-yl)-1,3,2-dioxaborolane represents a versatile building block in synthetic organic chemistry.
Formula:C13H23BO2
InChI:InChI=1S/C13H23BO2/c1-10-7-6-8-11(9-10)14-15-12(2,3)13(4,5)16-14/h9-10H,6-8H2,1-5H3
InChI key:InChIKey=WGEZNLKZTUCRTM-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(C)CCC2
Synonyms:
  • 4,4,5,5-Tetramethyl-2-(3-methylcyclohex-1-en-1-yl)-1,3,2-dioxaborolane
  • 4,4,5,5-Tetramethyl-2-(3-methyl-1-cyclohexen-1-yl)-1,3,2-dioxaborolane
  • 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(3-methyl-1-cyclohexen-1-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.