CAS 104700-95-0
:Ganoderic acid K
Description:
Ganoderic acid K is a triterpenoid compound primarily derived from the fruiting bodies of the Ganoderma lucidum mushroom, commonly known as reishi. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups, contributing to its bioactivity. Ganoderic acid K exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects, making it a subject of interest in medicinal chemistry and natural product research. Its mechanism of action is believed to involve modulation of cellular signaling pathways and inhibition of specific enzymes. Additionally, Ganoderic acid K is known for its role in traditional medicine, particularly in East Asian cultures, where reishi mushrooms have been used for centuries to promote health and longevity. The compound's solubility and stability can vary depending on the extraction method and formulation, which are important considerations for its application in dietary supplements and pharmaceuticals. Overall, Ganoderic acid K represents a significant area of study for its therapeutic potential and health benefits.
Formula:C32H46O9
InChI:InChI=1/C32H46O9/c1-15(11-18(34)12-16(2)28(39)40)19-13-23(37)32(8)24-20(35)14-21-29(4,5)22(36)9-10-30(21,6)25(24)26(38)27(31(19,32)7)41-17(3)33/h15-16,19-22,27,35-36H,9-14H2,1-8H3,(H,39,40)/t15-,16?,19-,20-,21+,22+,27-,30+,31+,32+/m1/s1
InChI key:InChIKey=OEHYQHPDUCRLMW-UHFFFAOYSA-N
SMILES:CC12C(C)(C(OC(C)=O)C(=O)C3=C1C(O)CC4C3(C)CCC(O)C4(C)C)C(C(CC(CC(C(O)=O)C)=O)C)CC2=O
Synonyms:- Ganoderic acid K
- (+)-Ganoderic acid K
- lanost-8-en-26-oic acid, 12-(acetyloxy)-3,7-dihydroxy-11,15,23-trioxo-, (3beta,7alpha,12beta)-
- Lanost-8-en-26-oic acid, 12-(acetyloxy)-3,7-dihydroxy-11,15,23-trioxo-, (3β,7β,12β)-
- (3β,7β,12β)-12-(Acetyloxy)-3,7-dihydroxy-11,15,23-trioxolanost-8-en-26-oic acid
- Lanost-8-en-26-oicacid, 12-(acetyloxy)-3,7-dihydroxy-11,15,23-trioxo-, (3b,7b,12b)-
- 12β-Acetyloxy-3β,7β-dihydroxy-11,15,23-trioxo-5α-lanost-8-en-26-oic acid
- (3beta,7beta,12beta)-12-(Acetyloxy)-3,7-dihydroxy-11,15,23-trioxolanost-8-en-26-oic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ganoderic acid K
CAS:Ganoderic acid K is an angiotensin-converting enzyme inhibitor. It has anti-tumor, and anti-inflammatory activities.Formula:C32H46O9Color and Shape:SolidMolecular weight:574.711Ganoderic acid K
CAS:<p>Ganoderic acid K is a triterpenoid compound, which is primarily derived from the mushroom species Ganoderma lucidum, commonly known as Reishi or Lingzhi. This species is a renowned medicinal fungus with a history of use in traditional Chinese medicine. The mode of action of ganoderic acid K involves modulating multiple signaling pathways, including inhibiting the synthesis of pro-inflammatory mediators and suppressing tumor growth through apoptosis induction. Additionally, it exhibits antioxidative properties by scavenging free radicals.</p>Formula:C32H46O9Purity:Min. 95%Molecular weight:574.70 g/mol

