CAS 104700-96-1
:Ganoderol B
Description:
Ganoderol B is a triterpenoid compound primarily derived from the Ganoderma lucidum, commonly known as reishi mushroom. It is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and hepatoprotective effects. Structurally, Ganoderol B features a complex arrangement of carbon rings typical of triterpenes, contributing to its biological activity. The compound has garnered interest in medicinal chemistry due to its potential therapeutic applications, particularly in traditional medicine practices. Research indicates that Ganoderol B may influence various biological pathways, including those related to immune modulation and cancer cell proliferation. Its solubility characteristics and stability under different conditions are also of interest for formulation in dietary supplements and herbal medicines. As with many natural products, further studies are necessary to fully elucidate its mechanisms of action and potential health benefits, as well as to assess its safety profile for human consumption.
Formula:C30H48O2
InChI:InChI=1S/C30H48O2/c1-20(19-31)9-8-10-21(2)22-13-17-30(7)24-11-12-25-27(3,4)26(32)15-16-28(25,5)23(24)14-18-29(22,30)6/h9,11,14,21-22,25-26,31-32H,8,10,12-13,15-19H2,1-7H3/b20-9+/t21-,22-,25+,26+,28-,29-,30+/m1/s1
InChI key:InChIKey=AOXXVRDKZLRGTJ-AZIDVCJLSA-N
SMILES:C[C@]12C=3C([C@]4(C)[C@@](CC3)(C(C)(C)[C@@H](O)CC4)[H])=CC[C@]1(C)[C@@]([C@@H](CC/C=C(/CO)\C)C)(CC2)[H]
Synonyms:- (3beta,24E)-Lanosta-7,9(11),24-trien-3,26-diol
- (3beta,24E)-lanosta-7,9(11),24-triene-3,26-diol
- (3beta,5xi,17alpha,24E)-lanosta-7,9(11),24-triene-3,26-diol
- (3β,24E)-Lanosta-7,9(11),24-triene-3,26-diol
- Ganodermadiol
- Lanosta-7,9(11),24-triene-3,26-diol, (3β,24E)-
- (+)-Ganoderol B
- Ganoderol B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ganoderol B
CAS:Ganoderol B with 5α-reductase inhibitory activity and the ability to bind to androgen receptor (AR) can inhibit androgen-induced LNCaP cell growth and suppress regrowth of the ventral prostate induced by testosterone in rats, suggests that ganoderol B might be useful in prostate cancer and benign prostatic hyperplasia (BPH) therapy through suppressing the function of androgen and its receptor.Formula:C30H48O2Purity:95%~99%Color and Shape:PowderMolecular weight:440.712Ganoderol B
CAS:Ganoderol B is a natural product isolated from Ganoderma lucidum and an α-glucosidase inhibitor with an IC50 of 119.8 μM, applicable for diabetes research.Formula:C30H48O2Purity:95.60%Color and Shape:SolidMolecular weight:440.7Ganoderol B
CAS:Controlled Product<p>Ganoderol B is a natural product that has been isolated from the fungus Ganoderma lucidum. It has significant cytotoxicity against herpes simplex virus and induces plaque formation in cells infected with this virus. The chemical structure of Ganoderol B is similar to cholesterol, which is synthesized by blocking the enzyme HMG-CoA reductase. This compound also inhibits other enzymes that are involved in cholesterol synthesis such as 3-hydroxy-3-methylglutaryl coenzyme A reductase, squalene synthase, and lanosterol synthase. As a result, Ganoderol B can reduce cholesterol levels and inhibit cancer cell growth.</p>Formula:C30H48O2Purity:Min. 95%Color and Shape:PowderMolecular weight:440.7 g/mol



