CAS 104700-98-3
:Ganoderal A
Description:
Ganoderal A is a triterpenoid compound primarily derived from the medicinal mushroom Ganoderma lucidum, commonly known as reishi. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups typical of triterpenes. Ganoderal A exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. Its mechanism of action may involve modulation of signaling pathways and inhibition of specific enzymes. The compound is typically studied in the context of traditional medicine and modern therapeutic applications, particularly in enhancing immune function and promoting overall health. As with many natural products, the extraction and purification processes can influence its bioactivity and efficacy. Ganoderal A's safety profile and potential side effects are also subjects of ongoing research, emphasizing the need for further studies to fully understand its therapeutic potential and mechanisms of action.
Formula:C30H44O2
InChI:InChI=1S/C30H44O2/c1-20(19-31)9-8-10-21(2)22-13-17-30(7)24-11-12-25-27(3,4)26(32)15-16-28(25,5)23(24)14-18-29(22,30)6/h9,11,14,19,21-22,25H,8,10,12-13,15-18H2,1-7H3/b20-9+/t21-,22-,25+,28-,29-,30+/m1/s1
InChI key:InChIKey=RHNFCIPJKSUUES-SPFFTVLFSA-N
SMILES:C[C@]12C=3C([C@]4(C)[C@@](CC3)(C(C)(C)C(=O)CC4)[H])=CC[C@]1(C)[C@@]([C@@H](CC/C=C(/C=O)\C)C)(CC2)[H]
Synonyms:- (+)-GanoderalA
- (24E)-3-Oxolanosta-7,9(11),24-trien-26-al
- Ganoderal A
- Lanosta-7,9(11),24-trien-26-al, 3-oxo-, (24E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(24E)-3-Oxolanosta-7,9(11),24-trien-26-al
CAS:Formula:C30H44O2Purity:97.54%Color and Shape:SolidMolecular weight:436.6692Ganoderal A
CAS:Controlled ProductGanoderma lucidum is a medicinal mushroom that is commonly used in traditional Chinese medicine. It has been shown to have a variety of biological activities, such as the promotion of wound healing and the inhibition of cholesterol synthesis. Ganoderma lucidum inhibits lipid accumulation by blocking the activity of 3-hydroxy-3-methylglutaryl coenzyme A reductase (HMGCR) and acetyl-CoA carboxylase (ACC). This mushroom also contains many chemical substances with inhibitory effects on phosphatases, such as proteases and proteinases. The most active compounds are ganoderal A, which inhibits human serum acid phosphatase, and ganoderic acid B, which inhibits rat neutrophil phagocytosis.Formula:C30H44O2Purity:Min. 95%Molecular weight:436.68 g/molGanoderal A
CAS:The oxygenated sterols( 26-oxygenosterols ganoderol A, ganoderol B, ganoderal A, and ganoderic acid Y) from G. lucidum can inhibit cholesterol biosynthesis via conversion of acetate or mevalonate as a precursor of cholesterol.Formula:C30H44O2Purity:98%Color and Shape:SolidMolecular weight:436.67




