CAS 104700-98-3: Ganoderal A
Description:Ganoderal A is a triterpenoid compound primarily derived from the medicinal mushroom Ganoderma lucidum, commonly known as reishi. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups typical of triterpenes. Ganoderal A exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. Its mechanism of action may involve modulation of signaling pathways and inhibition of specific enzymes. The compound is typically studied in the context of traditional medicine and modern therapeutic applications, particularly in enhancing immune function and promoting overall health. As with many natural products, the extraction and purification processes can influence its bioactivity and efficacy. Ganoderal A's safety profile and potential side effects are also subjects of ongoing research, emphasizing the need for further studies to fully understand its therapeutic potential and mechanisms of action.
Formula:C30H44O2
InChI:InChI=1S/C30H44O2/c1-20(19-31)9-8-10-21(2)22-13-17-30(7)24-11-12-25-27(3,4)26(32)15-16-28(25,5)23(24)14-18-29(22,30)6/h9,11,14,19,21-22,25H,8,10,12-13,15-18H2,1-7H3/b20-9+/t21-,22-,25+,28-,29-,30+/m1/s1
InChI key:InChIKey=RHNFCIPJKSUUES-SPFFTVLFSA-N
SMILES:O=CC(=CCCC(C)C1CCC2(C3=CCC4C(C(=O)CCC4(C3=CCC12C)C)(C)C)C)C
- Synonyms:
- (+)-GanoderalA
- (24E)-3-Oxolanosta-7,9(11),24-trien-26-al
- Ganoderal A
- Lanosta-7,9(11),24-trien-26-al, 3-oxo-, (24E)-

(24E)-3-Oxo-5α-lanosta-7,9(11),24-triene-26-al
Ref: IN-DA008YUQ
1mg | To inquire | ||
5mg | To inquire |

Ref: 7W-GY1064
Undefined size | To inquire |

Ganoderal A
Ref: TM-TN1655
5mg | To inquire | ||
1ml*10 (DMSO) | To inquire |

Ganoderal A
Ref: BP-BP3150
5mg | 557.00 € | ||
10mg | 897.00 € |

Ganoderal A
Controlled ProductRef: 3D-EEA70098
5mg | 765.00 € | ||
10mg | 1,151.00 € | ||
25mg | 1,877.00 € | ||
50mg | 3,002.00 € |