
CAS 104704-31-6
:5-(2-Furanyl)-3,4-dihydro-2H-pyrrole
Description:
5-(2-Furanyl)-3,4-dihydro-2H-pyrrole is an organic compound characterized by its unique structure, which includes a furan ring and a dihydropyrrole moiety. The presence of the furan ring imparts aromatic properties, while the dihydropyrrole contributes to its cyclic and saturated characteristics. This compound typically exhibits a moderate polarity due to the presence of heteroatoms in the furan ring, which can influence its solubility in various solvents. It may participate in various chemical reactions, including electrophilic substitutions and cycloadditions, owing to the reactivity of both the furan and pyrrole components. The compound's potential applications could span across pharmaceuticals, agrochemicals, and materials science, particularly in the development of novel compounds with specific biological activities or functional properties. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of interest in synthetic organic chemistry. Overall, 5-(2-Furanyl)-3,4-dihydro-2H-pyrrole represents a versatile structure with potential implications in various chemical fields.
Formula:C8H9NO
InChI:InChI=1S/C8H9NO/c1-3-7(9-5-1)8-4-2-6-10-8/h2,4,6H,1,3,5H2
InChI key:InChIKey=RSWIYWDWUHQXIZ-UHFFFAOYSA-N
SMILES:C=1(CCCN1)C2=CC=CO2
Synonyms:- 2H-Pyrrole, 5-(2-furanyl)-3,4-dihydro-
- 5-(2-Furanyl)-3,4-dihydro-2H-pyrrole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.