CymitQuimica logo

CAS 104704-41-8

:

1-Methyl-4-isoquinolinamine

Description:
1-Methyl-4-isoquinolinamine, with the CAS number 104704-41-8, is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. This substance features a methyl group attached to the nitrogen atom of the isoquinoline ring, contributing to its basicity and potential reactivity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, which may include effects on neurotransmitter systems. Its structure allows for interactions with various biological targets, making it a candidate for further research in drug development. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices. Overall, 1-Methyl-4-isoquinolinamine represents a unique compound with potential applications in pharmacology and organic synthesis.
Formula:C10H10N2
InChI:InChI=1S/C10H10N2/c1-7-8-4-2-3-5-9(8)10(11)6-12-7/h2-6H,11H2,1H3
InChI key:InChIKey=IKGHEEPPWYLINL-UHFFFAOYSA-N
SMILES:NC=1C2=C(C(C)=NC1)C=CC=C2
Synonyms:
  • 4-Isoquinolinamine, 1-methyl-
  • 1-Methyl-4-isoquinolinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.