CAS 10471-78-0
:2-ISOPROPENYL-2-OXAZOLINE 99+%
Description:
2-Isopropenyl-2-oxazoline, with the CAS number 10471-78-0, is a heterocyclic organic compound characterized by its five-membered ring structure containing both nitrogen and oxygen atoms. This compound is typically a colorless to pale yellow liquid and is known for its reactivity due to the presence of the isopropenyl group, which can participate in various polymerization reactions. It is soluble in organic solvents and exhibits moderate stability under standard conditions. 2-Isopropenyl-2-oxazoline is often utilized in the synthesis of polymers and copolymers, particularly in the production of functionalized materials, due to its ability to undergo ring-opening polymerization. Additionally, it can serve as a building block in organic synthesis, contributing to the development of more complex chemical structures. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate protective equipment should be used to minimize exposure.
Formula:C6H9NO
InChI:InChI=1S/C6H9NO/c1-5(2)6-7-3-4-8-6/h1,3-4H2,2H3
InChI key:InChIKey=LPIQIQPLUVLISR-UHFFFAOYSA-N
SMILES:C(C)(=C)C1=NCCO1
Synonyms:- 2-(1-Methylethenyl)-4,5-dihydrooxazole
- 2-(Prop-1-En-2-Yl)-4,5-Dihydro-1,3-Oxazole
- 2-Isopropenyl-2-oxazoline
- 2-Oxazoline, 2-isopropenyl-
- 4,5-Dihydro-2-(1-methylethenyl)oxazole
- Isopropenyloxazoline
- Oxazole, 4,5-dihydro-2-(1-methylethenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.