
CAS 104711-72-0
:2-(1-Methylethyl)oxazolo[4,5-b]pyridine
Description:
2-(1-Methylethyl)oxazolo[4,5-b]pyridine, with the CAS number 104711-72-0, is a heterocyclic organic compound characterized by the presence of both an oxazole and a pyridine ring in its structure. This compound typically exhibits properties associated with nitrogen-containing heterocycles, such as potential basicity due to the nitrogen atoms in the rings. It may also display moderate to high lipophilicity, influencing its solubility in organic solvents compared to water. The presence of the isopropyl group (1-methylethyl) can enhance its steric bulk, potentially affecting its reactivity and interactions with biological targets. Compounds of this type are often investigated for their pharmacological properties, as they may exhibit activity against various biological pathways. Additionally, the unique structural features may contribute to specific electronic properties, making them of interest in materials science and organic synthesis. Overall, 2-(1-Methylethyl)oxazolo[4,5-b]pyridine represents a class of compounds with diverse applications in medicinal chemistry and beyond.
Formula:C9H10N2O
InChI:InChI=1S/C9H10N2O/c1-6(2)9-11-8-7(12-9)4-3-5-10-8/h3-6H,1-2H3
InChI key:InChIKey=NNOFOEIKLFCVMF-UHFFFAOYSA-N
SMILES:C(C)(C)C1=NC=2C(O1)=CC=CN2
Synonyms:- 2-(1-Methylethyl)oxazolo[4,5-b]pyridine
- Oxazolo[4,5-b]pyridine, 2-(1-methylethyl)-
- 2-(Propan-2-yl)-[1,3]oxazolo[4,5-b]pyridine
- 2-Isopropyloxazolo[4,5-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.