CAS 104716-89-4

8-Fluoro-1,2,3,4-tetrahydro-1-((3,4,5-trimethoxyphenyl)methyl)-6,7-iso quinolinediol

Description:

8-Fluoro-1,2,3,4-tetrahydro-1-((3,4,5-trimethoxyphenyl)methyl)-6,7-isoquinolinediol, with CAS number 104716-89-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a fluorine atom and multiple methoxy groups. This compound features a tetrahydroisoquinoline core, which is a bicyclic structure known for its presence in various biologically active molecules. The presence of the fluorine atom can enhance the compound's lipophilicity and metabolic stability, potentially influencing its pharmacological properties. The trimethoxyphenyl group contributes to the compound's overall hydrophobic character and may play a role in its interaction with biological targets. Additionally, the hydroxyl groups in the isoquinoline structure can participate in hydrogen bonding, which may affect solubility and reactivity. Overall, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. However, specific biological effects and applications would require further investigation through experimental studies.

Formula: C₁₉H₂₂FNO₅

InChI: InChI=1/C19H22FNO5/c1-24-14-7-10(8-15(25-2)19(14)26-3)6-12-16-11(4-5-21-12)9-13(22)18(23)17(16)20/h7-9,12,21-23H,4-6H2,1-3H3

SMILES: COc1cc(CC2c3c(CCN2)cc(c(c3F)O)O)cc(c1OC)OC

Synonyms:

• 8-Fluorotrimetoquinol
• 8-Fluoro-1-(3,4,5-Trimethoxybenzyl)-1,2,3,4-Tetrahydroisoquinoline-6,7-Diol