CAS 10474-32-5
:2,3-Dihydro-2-methyl-2-phenyl-1H-inden-1-one
Description:
2,3-Dihydro-2-methyl-2-phenyl-1H-inden-1-one, with the CAS number 10474-32-5, is an organic compound characterized by its bicyclic structure, which includes an indene moiety. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of both methyl and phenyl groups enhances its hydrophobic characteristics, influencing its solubility in organic solvents while limiting its solubility in water. This compound may exhibit interesting chemical properties, including the ability to undergo various reactions such as electrophilic aromatic substitution and reduction, making it valuable in the synthesis of more complex organic molecules. Additionally, its structural features may impart specific biological activities, warranting further investigation in medicinal chemistry. Overall, 2,3-Dihydro-2-methyl-2-phenyl-1H-inden-1-one is a versatile compound with potential applications in both research and industry.
Formula:C16H14O
InChI:InChI=1S/C16H14O/c1-16(13-8-3-2-4-9-13)11-12-7-5-6-10-14(12)15(16)17/h2-10H,11H2,1H3
InChI key:InChIKey=CVZWTVDMZYGOSX-UHFFFAOYSA-N
SMILES:CC1(C(=O)C=2C(C1)=CC=CC2)C3=CC=CC=C3
Synonyms:- 1H-Inden-1-one, 2,3-dihydro-2-methyl-2-phenyl-
- 2-methyl-2-phenyl-2,3-dihydro-1H-inden-1-one
- 2,3-Dihydro-2-methyl-2-phenyl-1H-inden-1-one
- 2-Methyl-2-phenylindan-1-one
- 1-Indanone, 2-methyl-2-phenyl-
- 2-Methyl-2-phenyl-1-indanone
- 2-Methyl-2-phenyl-2,3-dihydro-1H-inden-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.