CymitQuimica logo

CAS 104746-00-1

:

(11-carbamoylbenzo[b][1]benzazepin-5-yl) hydrogen sulfate

Description:
(11-Carbamoylbenzo[b][1]benzazepin-5-yl) hydrogen sulfate, with the CAS number 104746-00-1, is a chemical compound that belongs to the class of benzazepines, which are characterized by a fused benzene and azepine ring structure. This compound features a carbamoyl group, which contributes to its potential biological activity, possibly influencing its interaction with various biological targets. The presence of the hydrogen sulfate moiety suggests that it may exhibit acidic properties, which can affect its solubility and reactivity in different environments. Compounds of this nature are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The specific characteristics, such as melting point, solubility, and reactivity, would depend on the compound's molecular structure and functional groups. As with many organic compounds, safety data and handling precautions are essential for laboratory work involving this substance, particularly due to its potential biological effects. Further research would be necessary to fully elucidate its properties and applications.
Formula:C15H12N2O5S
InChI:InChI=1/C15H12N2O5S/c16-15(18)17-12-7-3-1-5-10(12)9-14(22-23(19,20)21)11-6-2-4-8-13(11)17/h1-9H,(H2,16,18)(H,19,20,21)
SMILES:c1ccc2c(c1)C=C(c1ccccc1N2C(=N)O)OS(=O)(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.