CAS 10475-06-6
:5-AMINO-2-CHLORO-N,N-DIMETHYL-BENZENESULFONAMIDE
Description:
5-Amino-2-chloro-N,N-dimethyl-benzenesulfonamide, with the CAS number 10475-06-6, is a chemical compound that belongs to the class of sulfonamides. It features a sulfonamide functional group, which is characterized by the presence of a sulfonyl (SO2) moiety attached to an amine. This compound has a chlorine atom substituted at the 2-position of the benzene ring, along with two dimethylamino groups at the nitrogen atom. The presence of the amino group contributes to its potential as a biological active agent, often explored for its antibacterial properties. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the sulfonamide and amino groups. Its chemical structure suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions in biological systems. As with many sulfonamides, it may also be subject to specific regulatory considerations due to its pharmacological applications.
Formula:C8H11ClN2O2S
InChI:InChI=1/C8H11ClN2O2S/c1-11(2)14(12,13)8-5-6(10)3-4-7(8)9/h3-5H,10H2,1-2H3
SMILES:CN(C)S(=O)(=O)c1cc(ccc1Cl)N
Synonyms:- 5-Amino-2-chloro-N,N-dimethyl-benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
