CAS 104759-35-5
:Lanosta-7,9(11),24-trien-26-oicacid, 3-oxo-, (24E)-
Description:
Lanosta-7,9(11),24-trien-26-oic acid, 3-oxo-, (24E)-, with the CAS number 104759-35-5, is a triterpenoid compound characterized by its complex polycyclic structure derived from lanosterol. This substance features a triene configuration, indicating the presence of three double bonds within its carbon framework, which contributes to its reactivity and potential biological activity. The presence of a keto group at the 3-position and a carboxylic acid functional group at the 26-position enhances its chemical properties, making it a subject of interest in various biochemical studies. Triterpenoids like this compound are often investigated for their potential pharmacological effects, including anti-inflammatory, antimicrobial, and anticancer activities. Additionally, the stereochemistry denoted by (24E) indicates the specific geometric arrangement of atoms around the double bond, which can influence the compound's biological interactions. Overall, lanosta-7,9(11),24-trien-26-oic acid represents a significant class of natural products with diverse applications in medicinal chemistry and biochemistry.
Formula:C30H44O3
InChI:InChI=1S/C30H44O3/c1-19(9-8-10-20(2)26(32)33)21-13-17-30(7)23-11-12-24-27(3,4)25(31)15-16-28(24,5)22(23)14-18-29(21,30)6/h10-11,14,19,21,24H,8-9,12-13,15-18H2,1-7H3,(H,32,33)/b20-10+/t19-,21-,24+,28-,29-,30+/m1/s1
InChI key:InChIKey=AQUHIKXTCOSRFY-YAMUFALGSA-N
SMILES:C[C@]12C=3C([C@]4(C)[C@@](CC3)(C(C)(C)C(=O)CC4)[H])=CC[C@]1(C)[C@@]([C@@H](CC/C=C(/C(O)=O)\C)C)(CC2)[H]
Synonyms:- (24E)-3-Oxolanosta-7,9(11),24-trien-26-oic acid
- Ganoderic acid S
- Ganoderic acid S1
- Ganodericacid S
- Lanosta-7,9(11),24-trien-26-oic acid, 3-oxo-, (24E)-
- Gaderic acid S
- (24E)-3-Oxo-5α-lanosta-7,9(11),24-trien-26-oic acid
- Lanosta-7,9(11),24-trien-26-oicacid, 3-oxo-, (24E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(24E)-3-Oxo-5α-lanosta-7,9(11),24-trien-26-oic acid
CAS:Formula:C30H44O3Purity:97.0%Molecular weight:452.6686Ganoderic acid S1
CAS:Novel triterpenoid blend with GAS, GAT, GAMe, GAR, GMAS for treating various cancers; induces apoptosis in HeLa cells.Formula:C30H44O3Purity:98%Color and Shape:SolidMolecular weight:452.679Ganoderic acid S
CAS:Controlled Product<p>Ganoderic acid S is a triterpenoid compound that has been shown to inhibit the growth of human cancer cells in vitro. It contains a carbonyl group and an hydroxyl group, which are reactive molecules that can form covalent bonds with proteins and other molecules. Ganoderic acid S also has anti-inflammatory properties and can inhibit the release of growth factors, such as monoclonal antibodies, from immune cells. In addition, it inhibits the production of mitochondrial enzymes, such as hydroxylases and oxidases, by binding to the heme moiety in their active site.<br>Ganoderic acid S is found in rhizoma gastrodiae (a type of mushroom), which has been used for centuries in traditional Chinese medicine to treat various conditions. The populations of mice given ganoderic acid S orally for three months showed increased life span and reduced tumor incidence.</p>Purity:Min. 95%


