CAS 104761-43-5
:5-fluoro-(1,2,3,4-tetrahydro-7,12-dimethylbenz(a)anthracene)
Description:
5-Fluoro-(1,2,3,4-tetrahydro-7,12-dimethylbenz(a)anthracene) is a synthetic organic compound characterized by its complex polycyclic structure, which includes a fluorine atom substitution. This compound belongs to the class of polycyclic aromatic hydrocarbons (PAHs) and is notable for its potential biological activity, particularly in the context of cancer research, as it may serve as a model for studying the mechanisms of carcinogenesis. The presence of the fluorine atom can influence the compound's reactivity and biological interactions, potentially enhancing its lipophilicity and altering its metabolic pathways. Its tetrahydro structure indicates that it has undergone partial hydrogenation, which can affect its stability and solubility in various solvents. As with many PAHs, it is essential to handle this compound with care due to potential toxicity and environmental persistence. Research involving this compound often focuses on its role in biological systems, including its effects on cellular processes and its potential as a therapeutic agent or a tool in chemical biology.
Formula:C20H19F
InChI:InChI=1/C20H19F/c1-12-14-7-3-4-8-15(14)13(2)20-17-10-6-5-9-16(17)19(21)11-18(12)20/h3-4,7-8,11H,5-6,9-10H2,1-2H3
SMILES:Cc1c2ccccc2c(C)c2c3CCCCc3c(cc12)F
Synonyms:- 5-Fluoro-thdmba
- 5F-Thdmba
- Benz(a)anthracene, 5-fluoro-1,2,3,4-tetrahydro-7,12-dimethyl-
- 5-Fluoro-7,12-Dimethyl-1,2,3,4-Tetrahydrotetraphene
- 5-Fluoro-(1,2,3,4-tetrahydro-7,12-dimethylbenz(a)anthracene)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.