
CAS 1047620-82-5
:1H-Indole-1-ethanamine, N-methyl-, ethanedioate (1:1)
Description:
1H-Indole-1-ethanamine, N-methyl-, ethanedioate (1:1), with the CAS number 1047620-82-5, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a methyl group attached to the nitrogen of the ethylamine side chain, enhancing its basicity and potential for forming hydrogen bonds. The ethanedioate component indicates that it forms a salt with oxalic acid, which can influence its solubility and stability in various solvents. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The presence of the indole moiety is often associated with various pharmacological properties, including neuroactivity. Additionally, the compound's molecular interactions can be influenced by its functional groups, which may affect its reactivity and potential applications in medicinal chemistry. Overall, this compound represents a unique combination of structural features that may contribute to its chemical behavior and biological significance.
Formula:C11H14N2·C2H2O4
InChI:InChI=1S/C11H14N2.C2H2O4/c1-12-7-9-13-8-6-10-4-2-3-5-11(10)13;3-1(4)2(5)6/h2-6,8,12H,7,9H2,1H3;(H,3,4)(H,5,6)
InChI key:InChIKey=AGXBDUCMVQEBMI-UHFFFAOYSA-N
SMILES:C(CNC)N1C=2C(C=C1)=CC=CC2.C(C(O)=O)(O)=O
Synonyms:- 1H-Indole-1-ethanamine, N-methyl-, ethanedioate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.