CAS 1047630-55-6

5-Chloro-4-(1-methyl-1H-pyrazol-5-yl)-2-thiophenecarboxylic acid

Description:

5-Chloro-4-(1-methyl-1H-pyrazol-5-yl)-2-thiophenecarboxylic acid is a chemical compound characterized by its unique structural features, which include a thiophene ring, a carboxylic acid functional group, and a pyrazole moiety. The presence of chlorine at the 5-position of the thiophene ring contributes to its reactivity and potential biological activity. The pyrazole group, particularly with a methyl substitution, enhances the compound's lipophilicity and may influence its interaction with biological targets. This compound is typically studied for its potential applications in pharmaceuticals, particularly in the development of agrochemicals or medicinal agents due to its heterocyclic nature. Its solubility and stability can vary based on the pH and solvent used, which is crucial for its application in various chemical reactions or formulations. Overall, the compound's unique combination of functional groups and heterocycles makes it a subject of interest in synthetic chemistry and drug discovery.

Formula: C₉H₇ClN₂O₂S

InChI: InChI=1S/C9H7ClN2O2S/c1-12-6(2-3-11-12)5-4-7(9(13)14)15-8(5)10/h2-4H,1H3,(H,13,14)

InChI key: InChIKey=KBOSDMHARWSTCV-UHFFFAOYSA-N

SMILES: ClC1=C(C=C(C(O)=O)S1)C=2N(C)N=CC2

Synonyms:

• 2-Thiophenecarboxylic acid, 5-chloro-4-(1-methyl-1H-pyrazol-5-yl)-
• 5-Chloro-4-(1-methyl-1H-pyrazol-5-yl)-2-thiophenecarboxylic acid