CAS 1047634-65-0

Uprosertib

Description:

Uprosertib, with the CAS number 1047634-65-0, is a small molecule inhibitor primarily targeting the protein kinase AKT, which plays a crucial role in various cellular processes, including metabolism, proliferation, and survival. This compound is classified as a selective inhibitor, demonstrating potential therapeutic applications in oncology, particularly in cancers characterized by aberrant AKT signaling. Uprosertib has been investigated in clinical trials for its efficacy in combination with other treatments, aiming to enhance anti-tumor activity. Its chemical structure features specific functional groups that contribute to its binding affinity and selectivity for the AKT enzyme. The pharmacokinetic properties of Uprosertib, including absorption, distribution, metabolism, and excretion, are essential for determining its clinical utility and dosing regimens. As with many targeted therapies, understanding the resistance mechanisms and potential side effects is critical for optimizing its use in cancer treatment. Overall, Uprosertib represents a promising avenue in the development of targeted therapies aimed at improving outcomes for patients with certain malignancies.

Formula: C18H16Cl2F2N4O2

InChI: InChI=1S/C18H16Cl2F2N4O2/c1-26-16(12(19)8-24-26)11-6-15(28-17(11)20)18(27)25-10(7-23)4-9-2-3-13(21)14(22)5-9/h2-3,5-6,8,10H,4,7,23H2,1H3,(H,25,27)/t10-/m0/s1

InChI key: AXTAPYRUEKNRBA-JTQLQIEISA-N

SMILES: CN1C(=C(C=N1)Cl)C2=C(OC(=C2)C(=O)N[C@@H](CC3=CC(=C(C=C3)F)F)CN)Cl

GSK2141795

CAS: 1047634-65-0

Formula: C₁₈H₁₆Cl₂F₂N₄O₂

Purity: 99%

Color and Shape: Solid

Molecular weight: 429.2480

Ref: IN-DA008TGR

Uprosertib

CAS: 1047634-65-0

Uprosertib

Formula: C₁₈H₁₆Cl₂F₂N₄O₂

Purity: ≥95%

Molecular weight: 429.25

Ref: 54-BUP12455

Uprosertib

CAS: 1047634-65-0

Uprosertib (GSK2141795) is a potent, selective Akt broad-spectrum inhibitor for Akt1/Akt2/Akt3.Cost-effective and quality-assured.

Formula: C₁₈H₁₆Cl₂F₂N₄O₂

Purity: 95.62% - 99.73%

Color and Shape: Solid

Molecular weight: 429.248

Ref: TM-T6849

Uprosertib

CAS: 1047634-65-0

(S)-N-(1-Amino-3-(3,4-difluorophenyl)propan-2-yl)-5-chloro-4-(4-chloro-1-methyl-1H-pyrazol-5-yl)furan-2-carboxamide

Formula: C₁₈H₁₆Cl₂F₂N₄O₂

Purity: 99%

Molecular weight: 429.25

Ref: IN-DG290998

Uprosertib-13C4d3

Controlled Product

CAS: 1047634-65-0

Formula: C₁₄C₄H₁₃D₃Cl₂F₂N₄O₂

Color and Shape: Neat

Molecular weight: 436.237

Ref: TR-U800102

Uprosertib

CAS: 1047634-65-0

Inhibitor of ALK kinases; broad spectrum

Formula: C₁₈H₁₆Cl₂F₂N₄O₂

Purity: Min. 95%

Molecular weight: 429.25 g/mol

Ref: 3D-FU103960