CAS 1047652-33-4

Benzenemethanamine, N-[2-(1-cyclohexen-1-yl)ethyl]-, hydrochloride (1:1)

Description:

Benzenemethanamine, N-[2-(1-cyclohexen-1-yl)ethyl]-, hydrochloride (1:1), with CAS number 1047652-33-4, is a chemical compound characterized by its amine functional group and a cyclohexene moiety. This substance features a benzene ring attached to a methanamine group, which is further substituted with a 2-(1-cyclohexen-1-yl)ethyl group. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it more stable in various environments. The compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its reactivity and interactions with other molecules. Its structural features suggest potential applications in pharmaceuticals or organic synthesis, particularly in the development of compounds with specific biological activities. However, detailed studies would be necessary to fully understand its properties, including its pharmacological effects, toxicity, and potential uses in various fields.

Formula: C₁₅H₂₁N·ClH

InChI: InChI=1S/C15H21N.ClH/c1-3-7-14(8-4-1)11-12-16-13-15-9-5-2-6-10-15;/h2,5-7,9-10,16H,1,3-4,8,11-13H2;1H

InChI key: InChIKey=OJNRDADFRUXXSC-UHFFFAOYSA-N

SMILES: C(CNCC1=CC=CC=C1)C=2CCCCC2.Cl

Synonyms:

• Benzenemethanamine, N-[2-(1-cyclohexen-1-yl)ethyl]-, hydrochloride (1:1)