CAS 1047654-47-6
:4-(3-Fluorophenyl)-3-pyrrolidinecarboxylic acid
Description:
4-(3-Fluorophenyl)-3-pyrrolidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a fluorophenyl group. The presence of the fluorine atom on the phenyl ring can influence the compound's electronic properties and reactivity, potentially enhancing its biological activity. This compound is typically classified as an amino acid derivative due to the carboxylic acid functional group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The compound may exhibit specific solubility characteristics, stability under certain conditions, and reactivity with other chemical entities, which are crucial for its application in drug design. Additionally, the presence of the pyrrolidine moiety may contribute to its ability to interact with biological targets, making it of interest in the study of neuropharmacology or other therapeutic areas. As with any chemical substance, safety data and handling precautions should be observed when working with this compound in a laboratory setting.
Formula:C11H12FNO2
InChI:InChI=1S/C11H12FNO2/c12-8-3-1-2-7(4-8)9-5-13-6-10(9)11(14)15/h1-4,9-10,13H,5-6H2,(H,14,15)
InChI key:InChIKey=NKGQZNWWPOLORG-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(CNC1)C2=CC(F)=CC=C2
Synonyms:- 3-Pyrrolidinecarboxylic acid, 4-(3-fluorophenyl)-
- 4-(3-Fluorophenyl)-3-pyrrolidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.