CymitQuimica logo

CAS 1047654-48-7

:

4-(4-Bromophenyl)-3-pyrrolidinecarboxylic acid

Description:
4-(4-Bromophenyl)-3-pyrrolidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a bromophenyl group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the bromine atom on the phenyl ring enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The molecular structure allows for potential interactions with various biological targets, which may lead to applications in drug development. Additionally, the compound's solubility and stability can be affected by the presence of the bromine substituent and the carboxylic acid group. Its synthesis typically involves multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its identity and purity. Overall, 4-(4-Bromophenyl)-3-pyrrolidinecarboxylic acid represents a valuable compound for research in organic and medicinal chemistry.
Formula:C11H12BrNO2
InChI:InChI=1S/C11H12BrNO2/c12-8-3-1-7(2-4-8)9-5-13-6-10(9)11(14)15/h1-4,9-10,13H,5-6H2,(H,14,15)
InChI key:InChIKey=XXAATEOPXCAIIN-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(CNC1)C2=CC=C(Br)C=C2
Synonyms:
  • 4-(4-Bromophenyl)-3-pyrrolidinecarboxylic acid
  • 3-Pyrrolidinecarboxylic acid, 4-(4-bromophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.