CAS 1047676-26-5

5-(2-Thienyl)-4-thiazolecarboxylic acid

Description:

5-(2-Thienyl)-4-thiazolecarboxylic acid is a heterocyclic organic compound characterized by the presence of both thiazole and thiophene rings in its structure. This compound typically exhibits properties associated with heteroatoms, such as sulfur and nitrogen, which can influence its reactivity and solubility. It is likely to be a solid at room temperature and may have moderate to high polarity due to the carboxylic acid functional group, which can engage in hydrogen bonding. The thienyl group contributes to its aromatic character, potentially enhancing its stability and reactivity in various chemical reactions. This compound may be of interest in pharmaceutical chemistry due to its potential biological activity, as thiazole and thiophene derivatives are often explored for their medicinal properties. Additionally, its unique structure may allow for interactions with biological targets, making it a candidate for further research in drug development or agrochemical applications. As with many organic compounds, its behavior in different solvents and under varying conditions can provide insights into its practical applications.

Formula: C₈H₅NO₂S₂

InChI: InChI=1S/C8H5NO2S2/c10-8(11)6-7(13-4-9-6)5-2-1-3-12-5/h1-4H,(H,10,11)

InChI key: InChIKey=VAYKBVSQFCYPNE-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(SC=N1)C2=CC=CS2

Synonyms:

• 4-Thiazolecarboxylic acid, 5-(2-thienyl)-
• 5-(2-Thienyl)-4-thiazolecarboxylic acid