CAS 104768-35-6

2-{[(4-methylpyridin-2-yl)amino]methyl}phenol

Description:

2-{[(4-methylpyridin-2-yl)amino]methyl}phenol, identified by its CAS number 104768-35-6, is an organic compound characterized by its complex structure, which includes a phenolic group and a pyridine moiety. This compound features a phenol ring substituted with an amino group that is further connected to a 4-methylpyridine, indicating potential for hydrogen bonding and interactions with other molecules. The presence of the methyl group on the pyridine ring can influence its electronic properties and solubility. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Its solubility and stability can vary depending on the solvent and environmental conditions. Overall, 2-{[(4-methylpyridin-2-yl)amino]methyl}phenol is a versatile compound with potential applications in pharmaceuticals and materials science.

Formula: C₁₃H₁₄N₂O

InChI: InChI=1/C13H14N2O/c1-10-6-7-14-13(8-10)15-9-11-4-2-3-5-12(11)16/h2-8,16H,9H2,1H3,(H,14,15)

SMILES: Cc1ccnc(c1)NCc1ccccc1O

2-{[(4-Methyl-2-pyridinyl)amino]methyl}phenol

CAS: 104768-35-6

Versatile small molecule scaffold

Formula: C₁₃H₁₄N₂O

Purity: Min. 95%

Molecular weight: 214.26 g/mol

Ref: 3D-EEA76835