CAS 10477-94-8: Methylphenylpyridine
Description:Methylphenylpyridine, identified by its CAS number 10477-94-8, is an organic compound that belongs to the class of pyridines, which are aromatic heterocyclic compounds containing a nitrogen atom in the ring. This substance typically features a methyl group and a phenyl group attached to the pyridine ring, contributing to its unique chemical properties. Methylphenylpyridine is characterized by its moderate polarity, which influences its solubility in various organic solvents. It exhibits a distinct aromatic odor and is generally stable under standard conditions. The compound's structure allows for potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, its reactivity can be attributed to the presence of the nitrogen atom, which can participate in various chemical reactions, including electrophilic substitutions. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks upon exposure. Overall, methylphenylpyridine is a versatile compound with significant relevance in chemical research and industrial applications.
Formula:C12H11N
InChI:InChI=1/C12H11N/c1-10-7-12(9-13-8-10)11-5-3-2-4-6-11/h2-9H,1H3
- Synonyms:
- 3-Methyl-5-phenylpyridine
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 3-Methyl-5-phenylpyridine REF: 3B-M1094CAS: 10477-94-8 | >95.0%(GC) | 103.00 € | Mon 07 Apr 25 |
 | 3-Methyl-5-phenylpyridine REF: IN-DA003JQBCAS: 10477-94-8 | 98% | 108.00 €~177.00 € | Mon 14 Apr 25 |
 | 3-Methyl-5-phenylpyridine REF: 54-OR922029CAS: 10477-94-8 | 0.98 | 93.00 €~865.00 € | Mon 21 Apr 25 |
 | 3-Methyl-5-phenylpyridine REF: 10-F635572CAS: 10477-94-8 | 98% | To inquire | Thu 24 Apr 25 |
 | 3-Methyl-5-phenylpyridine REF: 3D-KAA47794CAS: 10477-94-8 | Min. 95% | - - - | Discontinued product |
3-Methyl-5-phenylpyridine
Ref: 3B-M1094
| 5g | 103.00 € |
3-Methyl-5-phenylpyridine
Ref: IN-DA003JQB
| 1g | 108.00 € | ||
| 5g | 177.00 € |
Ref: 54-OR922029
| 1g | 93.00 € | ||
| 5g | 388.00 € | ||
| 25g | 865.00 € |
3-Methyl-5-phenylpyridine
Ref: 10-F635572
| 5g | To inquire |
3-Methyl-5-phenylpyridine
Ref: 3D-KAA47794
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 50g | Discontinued | Request information |
