CAS 104770-29-8
:methyl 5-{[(4,6-dimethylpyrimidin-2-yl)carbamoyl]sulfamoyl}-1-(pyridin-2-yl)-1H-pyrazole-4-carboxylate
Description:
Methyl 5-{[(4,6-dimethylpyrimidin-2-yl)carbamoyl]sulfamoyl}-1-(pyridin-2-yl)-1H-pyrazole-4-carboxylate, with CAS number 104770-29-8, is a complex organic compound characterized by its multi-functional groups, including a pyrazole core, a pyrimidine moiety, and a sulfamoyl group. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, which may be attributed to its structural features that allow for interactions with biological targets. The presence of the methyl ester group suggests that it may undergo hydrolysis to release the corresponding carboxylic acid, potentially influencing its pharmacokinetic properties. Additionally, the compound's structure indicates possible applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as chromatography. Overall, this compound represents a class of molecules that may have significant implications in drug discovery and development.
Formula:C17H17N7O5S
InChI:InChI=1/C17H17N7O5S/c1-10-8-11(2)21-16(20-10)22-17(26)23-30(27,28)14-12(15(25)29-3)9-19-24(14)13-6-4-5-7-18-13/h4-9H,1-3H3,(H2,20,21,22,23,26)
SMILES:Cc1cc(C)nc(n1)N=C(NS(=O)(=O)c1c(cnn1c1ccccn1)C(=O)OC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.