CAS 104778-58-7
:1-benzyl-3-(chloromethyl)piperidine
Description:
1-Benzyl-3-(chloromethyl)piperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The structure features a benzyl group attached to the nitrogen atom of the piperidine, enhancing its lipophilicity and potential for biological activity. The presence of a chloromethyl group at the 3-position introduces a reactive site, making it useful in various synthetic applications, including as an intermediate in the synthesis of pharmaceuticals or agrochemicals. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is important to handle this substance with care due to the presence of the chloromethyl group, which can be reactive and potentially hazardous. The compound's properties, such as solubility and stability, can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, it is essential to consider safety data and regulatory guidelines when working with 1-benzyl-3-(chloromethyl)piperidine.
Formula:C13H18ClN
InChI:InChI=1/C13H18ClN/c14-9-13-7-4-8-15(11-13)10-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2
SMILES:c1ccc(cc1)CN1CCCC(CCl)C1
Synonyms:- Piperidine, 3-(Chloromethyl)-1-(Phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
