CymitQuimica logo

CAS 10478-43-0

:

3-(Nitrosopropylamino)propanoic acid

Description:
3-(Nitrosopropylamino)propanoic acid, identified by its CAS number 10478-43-0, is a chemical compound that features a propanoic acid backbone with a nitrosopropylamino group. This compound is characterized by the presence of both a carboxylic acid functional group and a nitroso group, which can influence its reactivity and biological activity. The nitrosamine structure suggests potential implications in biological systems, particularly in relation to nitrosation reactions, which can lead to the formation of carcinogenic compounds. The compound may exhibit polar characteristics due to the carboxylic acid group, affecting its solubility in water and organic solvents. Additionally, the presence of the amino group can facilitate interactions with biological macromolecules, potentially influencing its pharmacological properties. Overall, 3-(Nitrosopropylamino)propanoic acid is of interest in both synthetic chemistry and toxicology, warranting further investigation into its properties and effects.
Formula:C6H12N2O3
InChI:InChI=1S/C6H12N2O3/c1-2-4-8(7-11)5-3-6(9)10/h2-5H2,1H3,(H,9,10)
InChI key:InChIKey=LGQRXYUGRFHNHK-UHFFFAOYSA-N
SMILES:N(CCC(O)=O)(CCC)N=O
Synonyms:
  • Propanoic acid, 3-(nitrosopropylamino)-
  • N-Propyl-N-(2-carboxyethyl)nitrosamine
  • 3-(Nitrosopropylamino)propanoic acid
  • β-Alanine, N-nitroso-N-propyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.