CAS 104786-99-4

N-Formyl-5-asa

Description:

N-Formyl-5-asa, also known as N-formyl-5-aminosalicylic acid, is a chemical compound that belongs to the class of salicylates. It is characterized by the presence of a formyl group (-CHO) attached to the amino group of 5-aminosalicylic acid, which is a derivative of salicylic acid. This compound exhibits properties typical of both amines and carboxylic acids, making it potentially useful in various chemical reactions and applications. N-Formyl-5-asa is primarily studied for its potential therapeutic effects, particularly in the treatment of inflammatory bowel diseases, due to its anti-inflammatory properties. The compound is soluble in polar solvents, which enhances its bioavailability. Its molecular structure allows for interactions with biological targets, contributing to its pharmacological profile. As with many chemical substances, safety and handling precautions are essential, as it may exhibit toxicity or irritant properties. Further research is ongoing to fully elucidate its mechanisms of action and potential applications in medicinal chemistry.

Formula: C₈H₇NO₄

InChI: InChI=1/C8H7NO4/c10-4-9-5-1-2-7(11)6(3-5)8(12)13/h1-4,11H,(H,9,10)(H,12,13)

SMILES: c1cc(c(cc1N=CO)C(=O)O)O

Synonyms:

• N-formamidosalicylic acid
• 5-(Formylamino)-2-Hydroxybenzoic Acid

5-Formamido-2-hydroxybenzoic acid

CAS: 104786-99-4

5-Formamido-2-hydroxybenzoic acid

Purity: 98%

Molecular weight: 181.15g/mol

Ref: 54-OR1062980

N-Formyl Mesalazine

Controlled Product

CAS: 104786-99-4

Applications A metabolite of Mesalazine (M258100).
References Allgayer, H., et al.: Arzneim.-Forsch., 35, 1457 (1985), Cui, F., et al.: J. Pharm. Biomed. Anal., 34, 189 (2004),

Formula: C₈H₇NO₄

Color and Shape: Neat

Molecular weight: 181.15

Ref: TR-F700695

N-Formyl Mesalazine

CAS: 104786-99-4

Formula: C₈H₇NO₄

Molecular weight: 181.15

Ref: ST-EA-CP-M11020