
CAS 10479-68-2
:rel-(3aR,7aS)-Octahydro-1H-isoindol-1-one
Description:
Rel-(3aR,7aS)-Octahydro-1H-isoindol-1-one, with the CAS number 10479-68-2, is a bicyclic compound characterized by its unique structural features, including a saturated octahydro framework and an isoindole moiety. This compound exhibits a specific stereochemistry, denoted by the rel-(3aR,7aS) configuration, which influences its chemical reactivity and potential biological activity. Typically, such compounds may display properties relevant to medicinal chemistry, including potential neuroactive effects or applications in drug development. The presence of the carbonyl group in the isoindol-1-one structure suggests that it may participate in various chemical reactions, such as nucleophilic additions or cycloadditions. Additionally, the saturated nature of the octahydro ring system contributes to its stability and solubility characteristics. Overall, rel-(3aR,7aS)-Octahydro-1H-isoindol-1-one represents a compound of interest in organic synthesis and pharmacology, warranting further investigation into its properties and potential applications.
Formula:C8H13NO
InChI:InChI=1/C8H13NO/c10-8-7-4-2-1-3-6(7)5-9-8/h6-7H,1-5H2,(H,9,10)/t6-,7-/s2
InChI key:InChIKey=JKYNCKNIVHDOKU-WZTWBHKBNA-N
SMILES:O=C1[C@@]2([C@@](CCCC2)(CN1)[H])[H]
Synonyms:- 1H-Isoindol-1-one, octahydro-, cis-
- 1H-Isoindol-1-one, octahydro-, (3aR,7aS)-rel-
- rel-(3aR,7aS)-Octahydro-1H-isoindol-1-one
- cis-Octahydro-1H-isoindol-1-one
- octahydro-1H-isoindol-1-one
- Phthalimidine, hexahydro-, cis-
Sort by
Purity (%)
0
100
|
 0
|
 50
|
 90
|
 95
|
 100
Found 2 products.
- Ref: 4Z-M-50165mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire
- rac-(3aR,7aS)-Octahydro-1H-isoindol-1-oneCAS:Racemic octahydro-1H-isoindol-1-one is a compound that has been shown to have both inhibitory and stimulatory effects on the adrenergic receptors. It blocks the ATP-sensitive K+ channel, which causes an increase in intracellular calcium levels. This leads to the activation of phospholipase A2 and protein kinase C. Racemic octahydro-1H-isoindol-1-one also inhibits 5HT3 receptor antagonists, which are implicated in nausea and vomiting. Racemic octahydro-1H-isoindol-1-one also has been found to be a selective inhibitor of tyrosine kinases. The racemic mixture of octahydro isoindole 1, one isomer being more potent than the other. Racemic octahydro isoindole 1, one is a competitive inhibitor at serotonin transporter (SERT) and norepinephrine transporter (NET).Formula:C8H13NOPurity:Min. 95%Molecular weight:139.19 g/mol- Ref: 3D-KAA4796850mg576.00€500mg1,600.00€





